ARTICLES

There are two alternative chemical formulas for the common household shampoo, namely, CH3(CH2)10CH2(OCH2CH2)2OSO3Na and NaC12H25SO4. They represent sodium laureth sulfate and sodium lauryl sulfate, respectively.

www.reference.com/science/chemical-formula-shampoo-17ed1c25896de795

There are 18 ingredients listed for Johnson's Baby Shampoo, including cocamidopropyl betaine, sodium chloride, sodium trideceth sulfate, glycerin and citric acid. The first ingredient in the shampoo is water, and it also...

www.reference.com/world-view/ingredients-johnson-s-baby-shampoo-cd8c565a17eee435

Pura D’or Hair Loss Prevention Premium Organic Shampoo is the number one best-selling hair growth and hair loss prevention shampoo on Amazon.com. The shampoo’s unique formula uses natural coconut derivatives, herbal extr...

www.reference.com/article/shampoo-helps-hair-grow-abbc33a8ba850a7d

SIMILAR ARTICLES

The formula for the chemical compound aluminum acetate is Al(C2H3O2)3. However, its molecular formula is given as C6H9O6Al.

www.reference.com/science/formula-aluminum-acetate-282c4e93d0e90a2b

Boron hydrides are a class of compounds that include the chemical structure BxHy; for example, diborane with the chemical formula B2H6. Boron hydrides are also called boranes.

www.reference.com/article/boron-hydride-685bad74d120b2ac

The molecular formula "FeO2" is a general formula that can represent several chemical compounds: Iron(II) hydroxide, iron oxide and Oxido (oxo) iron. Iron oxide is the most common name for it.

www.reference.com/article/feo2-6aec7ccb62af47b0

Ammonia is the chemical name for the molecular formula NH3, which is a compound of nitrogen and hydrogen. It is also known by the name azane.

www.reference.com/science/chemical-name-ammonia-5823511e87461f6c