ARTICLES

There are two alternative chemical formulas for the common household shampoo, namely, CH3(CH2)10CH2(OCH2CH2)2OSO3Na and NaC12H25SO4. They represent sodium laureth sulfate and sodium lauryl sulfate, respectively.

www.reference.com/science/chemical-formula-shampoo-17ed1c25896de795

Sodium laureth sulfate, sodium lauryl sulfate, fragrance and parabens are some chemicals commonly used in most major brands of shampoos. These chemicals are usually linked with unnecessary health risks and are seen as ha...

www.reference.com/article/chemicals-used-major-brands-shampoos-edae32160627f16e

Shampoos are made of a class of chemicals called surfactants, which have the ability to lower the surface tension of a liquid. These surface-active substances surround oily substances and dirt, which then makes it easier...

www.reference.com/article/shampoo-made-19b367b0b8e8f05a

SIMILAR ARTICLES

The formula for the chemical compound aluminum acetate is Al(C2H3O2)3. However, its molecular formula is given as C6H9O6Al.

www.reference.com/science/formula-aluminum-acetate-282c4e93d0e90a2b

Boron hydrides are a class of compounds that include the chemical structure BxHy; for example, diborane with the chemical formula B2H6. Boron hydrides are also called boranes.

www.reference.com/article/boron-hydride-685bad74d120b2ac

The molecular formula "FeO2" is a general formula that can represent several chemical compounds: Iron(II) hydroxide, iron oxide and Oxido (oxo) iron. Iron oxide is the most common name for it.

www.reference.com/article/feo2-6aec7ccb62af47b0

Ammonia is the chemical name for the molecular formula NH3, which is a compound of nitrogen and hydrogen. It is also known by the name azane.

www.reference.com/science/chemical-name-ammonia-5823511e87461f6c