ARTICLES

There are two alternative chemical formulas for the common household shampoo, namely, CH3(CH2)10CH2(OCH2CH2)2OSO3Na and NaC12H25SO4. They represent sodium laureth sulfate and sodium lauryl sulfate, respectively.

www.reference.com/science/chemical-formula-shampoo-17ed1c25896de795

According to Chemical Dictionary, the chemical formula for Milk of Magnesia is Mg(OH)2. It is also referred to as magnesium hydroxide, magnesium hydrate or magnesia magma.

www.reference.com/article/chemical-formula-milk-magnesia-a37cff2768765028

Graphite's chemical formula is C. Graphite is a carbon allotrope, meaning that it has the same chemical composition as carbon, but it has different physical characteristics.

www.reference.com/science/chemical-formula-graphite-4db23f318c310b83

SIMILAR ARTICLES

Ammonia is the chemical name for the molecular formula NH3, which is a compound of nitrogen and hydrogen. It is also known by the name azane.

www.reference.com/science/chemical-name-ammonia-5823511e87461f6c

Paraffin is a mixture of hydrocarbon molecules with the general chemical formula CnH2n+2. The word "paraffin" is derived from Latin words "parum" and "affinis," which translate to "lack of affinity." This lack of affinit...

www.reference.com/article/chemical-formula-paraffin-cde913a7dbe7d856

The molecular formula "FeO2" is a general formula that can represent several chemical compounds: Iron(II) hydroxide, iron oxide and Oxido (oxo) iron. Iron oxide is the most common name for it.

www.reference.com/article/feo2-6aec7ccb62af47b0

Boron hydrides are a class of compounds that include the chemical structure BxHy; for example, diborane with the chemical formula B2H6. Boron hydrides are also called boranes.

www.reference.com/article/boron-hydride-685bad74d120b2ac